Fisetin

Name: fisetholz;fustel;fustet;jungerfustik;
superfustel;superfustelk;ungarischesgelbholz;3,7,3',4'-TETRAHYDROXYFLAVONE

Compound CID: 5281614

MF: C15H10O6 MW: 286.24g/mol

IUPAC Name: 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one

Isomeric SMILES: C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O

InChIKey: XHEFDIBZLJXQHF-UHFFFAOYSA-N

InChI: InChI=1S/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H

Create Date: 2005-03-26

Item No.: 0016

Fisetin is a flavonol that belongs to the flavonoid group of polyphenols. It can be found in various plants, such as strawberries, apples, persimmon, grapes, onions, and cucumbers.

What is Fisetin?

Fisetin is a natural substance found in many plants. It's a senotherapeutic that extends health and lifespan. What’s more, fisetin has powerful anti-inflammatory, antioxidant, and immune-supporting properties.


Benefits

1.) Fisetin helps improve our immune system and prevent hyperdrive;

2.) It can influence the process of aging;

3.) It shows anti-cancer abilities.